C32H37NO3 — CID 130357529
5-(4-hexan-3-yloxyphenyl)-6-(4-methoxy-2-methylphenyl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxamide (PubChem CID 130357529) has the molecular formula C32H37NO3 and a molecular weight of 483.65 g/mol. Its IUPAC name is 5-(4-hexan-3-yloxyphenyl)-6-(4-methoxy-2-methylphenyl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxamide.
| Compound Name | 5-(4-hexan-3-yloxyphenyl)-6-(4-methoxy-2-methylphenyl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxamide |
|---|---|
| PubChem CID | 130357529 |
| Molecular Formula | C32H37NO3 |
| Molecular Weight | 483.65 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | 5-(4-hexan-3-yloxyphenyl)-6-(4-methoxy-2-methylphenyl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxamide |
| SMILES | CCCC(CC)Oc1ccc(C2=C(c3ccc(OC)cc3C)CCCc3cc(C(N)=O)ccc32)cc1 |
| InChI | InChI=1S/C32H37NO3/c1-5-8-25(6-2)36-26-14-11-22(12-15-26)31-29-17-13-24(32(33)34)20-23(29)9-7-10-30(31)28-18-16-27(35-4)19-21(28)3/h11-20,25H,5-10H2,1-4H3,(H2,33,34) |
| InChIKey | AOXHSOONNNTSAS-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.65 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|