C26H24O3 — CID 176863851
6-(2,4-dimethylphenyl)-5-(3-hydroxyphenyl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid (PubChem CID 176863851) has the molecular formula C26H24O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 6-(2,4-dimethylphenyl)-5-(3-hydroxyphenyl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid.
| Compound Name | 6-(2,4-dimethylphenyl)-5-(3-hydroxyphenyl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid |
|---|---|
| PubChem CID | 176863851 |
| Molecular Formula | C26H24O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 6-(2,4-dimethylphenyl)-5-(3-hydroxyphenyl)-8,9-dihydro-7H-benzo[7]annulene-2-carboxylic acid |
| SMILES | Cc1ccc(C2=C(c3cccc(O)c3)c3ccc(C(=O)O)cc3CCC2)c(C)c1 |
| InChI | InChI=1S/C26H24O3/c1-16-9-11-22(17(2)13-16)24-8-4-5-18-14-20(26(28)29)10-12-23(18)25(24)19-6-3-7-21(27)15-19/h3,6-7,9-15,27H,4-5,8H2,1-2H3,(H,28,29) |
| InChIKey | UVIYPRBVYDVFSR-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|