C24H21FO2 — CID 156716310
2-fluoro-6-[5-(4-hydroxyphenyl)-2-methyl-8,9-dihydro-7H-benzo[7]annulen-6-yl]phenol (PubChem CID 156716310) has the molecular formula C24H21FO2 and a molecular weight of 360.43 g/mol. Its IUPAC name is 2-fluoro-6-[5-(4-hydroxyphenyl)-2-methyl-8,9-dihydro-7H-benzo[7]annulen-6-yl]phenol.
| Compound Name | 2-fluoro-6-[5-(4-hydroxyphenyl)-2-methyl-8,9-dihydro-7H-benzo[7]annulen-6-yl]phenol |
|---|---|
| PubChem CID | 156716310 |
| Molecular Formula | C24H21FO2 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-fluoro-6-[5-(4-hydroxyphenyl)-2-methyl-8,9-dihydro-7H-benzo[7]annulen-6-yl]phenol |
| SMILES | Cc1ccc2c(c1)CCCC(c1cccc(F)c1O)=C2c1ccc(O)cc1 |
| InChI | InChI=1S/C24H21FO2/c1-15-8-13-19-17(14-15)4-2-5-20(21-6-3-7-22(25)24(21)27)23(19)16-9-11-18(26)12-10-16/h3,6-14,26-27H,2,4-5H2,1H3 |
| InChIKey | MBMIBEUYPUVIBR-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|