C31H33F2NO4 — CID 130357499
3-fluoro-1-[3-[4-[6-(2-fluoro-4-methylphenyl)-2-hydroxy-8,9-dihydro-7H-benzo[7]annulen-5-yl]phenoxy]pyrrolidin-1-yl]propane-1,1-diol (PubChem CID 130357499) has the molecular formula C31H33F2NO4 and a molecular weight of 521.60 g/mol. Its IUPAC name is 3-fluoro-1-[3-[4-[6-(2-fluoro-4-methylphenyl)-2-hydroxy-8,9-dihydro-7H-benzo[7]annulen-5-yl]phenoxy]pyrrolidin-1-yl]propane-1,1-diol.
| Compound Name | 3-fluoro-1-[3-[4-[6-(2-fluoro-4-methylphenyl)-2-hydroxy-8,9-dihydro-7H-benzo[7]annulen-5-yl]phenoxy]pyrrolidin-1-yl]propane-1,1-diol |
|---|---|
| PubChem CID | 130357499 |
| Molecular Formula | C31H33F2NO4 |
| Molecular Weight | 521.60 g/mol |
| Exact Mass | 521.24 |
| IUPAC Name | 3-fluoro-1-[3-[4-[6-(2-fluoro-4-methylphenyl)-2-hydroxy-8,9-dihydro-7H-benzo[7]annulen-5-yl]phenoxy]pyrrolidin-1-yl]propane-1,1-diol |
| SMILES | Cc1ccc(C2=C(c3ccc(OC4CCN(C(O)(O)CCF)C4)cc3)c3ccc(O)cc3CCC2)c(F)c1 |
| InChI | InChI=1S/C31H33F2NO4/c1-20-5-11-27(29(33)17-20)28-4-2-3-22-18-23(35)8-12-26(22)30(28)21-6-9-24(10-7-21)38-25-13-16-34(19-25)31(36,37)14-15-32/h5-12,17-18,25,35-37H,2-4,13-16,19H2,1H3 |
| InChIKey | SOPNJTZIPRTSCX-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.60 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|