C32H37FN2O — CID 156716327
6-(2,4-dimethylphenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-amine (PubChem CID 156716327) has the molecular formula C32H37FN2O and a molecular weight of 484.66 g/mol. Its IUPAC name is 6-(2,4-dimethylphenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-amine.
| Compound Name | 6-(2,4-dimethylphenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-amine |
|---|---|
| PubChem CID | 156716327 |
| Molecular Formula | C32H37FN2O |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | 6-(2,4-dimethylphenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-amine |
| SMILES | Cc1ccc(C2=C(c3ccc(OC4CCN(CCCF)C4)cc3)c3ccc(N)cc3CCC2)c(C)c1 |
| InChI | InChI=1S/C32H37FN2O/c1-22-7-13-29(23(2)19-22)31-6-3-5-25-20-26(34)10-14-30(25)32(31)24-8-11-27(12-9-24)36-28-15-18-35(21-28)17-4-16-33/h7-14,19-20,28H,3-6,15-18,21,34H2,1-2H3 |
| InChIKey | RXLSXARXTBLAFW-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|