C31H35FN2O2 — CID 130357543
5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-6-(4-methoxyphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-amine (PubChem CID 130357543) has the molecular formula C31H35FN2O2 and a molecular weight of 486.63 g/mol. Its IUPAC name is 5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-6-(4-methoxyphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-amine.
| Compound Name | 5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-6-(4-methoxyphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-amine |
|---|---|
| PubChem CID | 130357543 |
| Molecular Formula | C31H35FN2O2 |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.27 |
| IUPAC Name | 5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-6-(4-methoxyphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-amine |
| SMILES | COc1ccc(C2=C(c3ccc(OC4CCN(CCCF)C4)cc3)c3ccc(N)cc3CCC2)cc1 |
| InChI | InChI=1S/C31H35FN2O2/c1-35-26-11-6-22(7-12-26)29-5-2-4-24-20-25(33)10-15-30(24)31(29)23-8-13-27(14-9-23)36-28-16-19-34(21-28)18-3-17-32/h6-15,20,28H,2-5,16-19,21,33H2,1H3 |
| InChIKey | DSQGIYCYZYMQAI-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|