C30H32F2N2O2 — CID 166841574
3-[2-amino-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-6-yl]-2-fluorophenol (PubChem CID 166841574) has the molecular formula C30H32F2N2O2 and a molecular weight of 490.59 g/mol. Its IUPAC name is 3-[2-amino-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-6-yl]-2-fluorophenol.
| Compound Name | 3-[2-amino-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-6-yl]-2-fluorophenol |
|---|---|
| PubChem CID | 166841574 |
| Molecular Formula | C30H32F2N2O2 |
| Molecular Weight | 490.59 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 3-[2-amino-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-6-yl]-2-fluorophenol |
| SMILES | Nc1ccc2c(c1)CCCC(c1cccc(O)c1F)=C2c1ccc(OC2CCN(CCCF)C2)cc1 |
| InChI | InChI=1S/C30H32F2N2O2/c31-15-3-16-34-17-14-24(19-34)36-23-11-8-20(9-12-23)29-25-13-10-22(33)18-21(25)4-1-5-26(29)27-6-2-7-28(35)30(27)32/h2,6-13,18,24,35H,1,3-5,14-17,19,33H2 |
| InChIKey | YYAQADWVXDOXFH-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.59 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|