C37H38ClFN2O3 — CID 170286052
2-[2-[2-[amino(hydroxy)methyl]phenyl]-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-6-yl]-5-chlorophenol (PubChem CID 170286052) has the molecular formula C37H38ClFN2O3 and a molecular weight of 613.17 g/mol. Its IUPAC name is 2-[2-[2-[amino(hydroxy)methyl]phenyl]-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-6-yl]-5-chlorophenol.
| Compound Name | 2-[2-[2-[amino(hydroxy)methyl]phenyl]-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-6-yl]-5-chlorophenol |
|---|---|
| PubChem CID | 170286052 |
| Molecular Formula | C37H38ClFN2O3 |
| Molecular Weight | 613.17 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | 2-[2-[2-[amino(hydroxy)methyl]phenyl]-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-6-yl]-5-chlorophenol |
| SMILES | NC(O)c1ccccc1-c1ccc2c(c1)CCCC(c1ccc(Cl)cc1O)=C2c1ccc(OC2CCN(CCCF)C2)cc1 |
| InChI | InChI=1S/C37H38ClFN2O3/c38-27-12-16-32(35(42)22-27)33-8-3-5-25-21-26(30-6-1-2-7-34(30)37(40)43)11-15-31(25)36(33)24-9-13-28(14-10-24)44-29-17-20-41(23-29)19-4-18-39/h1-2,6-7,9-16,21-22,29,37,42-43H,3-5,8,17-20,23,40H2 |
| InChIKey | KOVVFHYCNDADBS-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.17 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|