C31H32Cl2FN3O2 — CID 156716337
6-(2,4-dichlorophenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-N'-hydroxy-8,9-dihydro-7H-benzo[7]annulene-2-carboximidamide (PubChem CID 156716337) has the molecular formula C31H32Cl2FN3O2 and a molecular weight of 568.52 g/mol. Its IUPAC name is 6-(2,4-dichlorophenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-N'-hydroxy-8,9-dihydro-7H-benzo[7]annulene-2-carboximidamide.
| Compound Name | 6-(2,4-dichlorophenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-N'-hydroxy-8,9-dihydro-7H-benzo[7]annulene-2-carboximidamide |
|---|---|
| PubChem CID | 156716337 |
| Molecular Formula | C31H32Cl2FN3O2 |
| Molecular Weight | 568.52 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | 6-(2,4-dichlorophenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-N'-hydroxy-8,9-dihydro-7H-benzo[7]annulene-2-carboximidamide |
| SMILES | N/C(=N/O)c1ccc2c(c1)CCCC(c1ccc(Cl)cc1Cl)=C2c1ccc(OC2CCN(CCCF)C2)cc1 |
| InChI | InChI=1S/C31H32Cl2FN3O2/c32-23-8-12-27(29(33)18-23)28-4-1-3-21-17-22(31(35)36-38)7-11-26(21)30(28)20-5-9-24(10-6-20)39-25-13-16-37(19-25)15-2-14-34/h5-12,17-18,25,38H,1-4,13-16,19H2,(H2,35,36) |
| InChIKey | WUTMWEJKHKULCL-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.52 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|