C34H35Cl2FN2O2 — CID 170285702
1-[6-(2,4-dichlorophenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-yl]ethenyl N-methylmethanimidate (PubChem CID 170285702) has the molecular formula C34H35Cl2FN2O2 and a molecular weight of 593.57 g/mol. Its IUPAC name is 1-[6-(2,4-dichlorophenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-yl]ethenyl N-methylmethanimidate.
| Compound Name | 1-[6-(2,4-dichlorophenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-yl]ethenyl N-methylmethanimidate |
|---|---|
| PubChem CID | 170285702 |
| Molecular Formula | C34H35Cl2FN2O2 |
| Molecular Weight | 593.57 g/mol |
| Exact Mass | 592.21 |
| IUPAC Name | 1-[6-(2,4-dichlorophenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-yl]ethenyl N-methylmethanimidate |
| SMILES | C=C(O/C=N/C)c1ccc2c(c1)CCCC(c1ccc(Cl)cc1Cl)=C2c1ccc(OC2CCN(CCCF)C2)cc1 |
| InChI | InChI=1S/C34H35Cl2FN2O2/c1-23(40-22-38-2)25-9-13-30-26(19-25)5-3-6-32(31-14-10-27(35)20-33(31)36)34(30)24-7-11-28(12-8-24)41-29-15-18-39(21-29)17-4-16-37/h7-14,19-20,22,29H,1,3-6,15-18,21H2,2H3/b38-22+ |
| InChIKey | HPCKNOUXWLAIMV-NNLKUIAGSA-N |
| XLogP | 8.75 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.57 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|