C36H40Cl2FN3O3S — CID 175226957
tert-butyl-[[6-(2,4-dichlorophenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carbothioyl]amino]carbamic acid (PubChem CID 175226957) has the molecular formula C36H40Cl2FN3O3S and a molecular weight of 684.71 g/mol. Its IUPAC name is tert-butyl-[[6-(2,4-dichlorophenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carbothioyl]amino]carbamic acid.
| Compound Name | tert-butyl-[[6-(2,4-dichlorophenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carbothioyl]amino]carbamic acid |
|---|---|
| PubChem CID | 175226957 |
| Molecular Formula | C36H40Cl2FN3O3S |
| Molecular Weight | 684.71 g/mol |
| Exact Mass | 683.22 |
| IUPAC Name | tert-butyl-[[6-(2,4-dichlorophenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulene-2-carbothioyl]amino]carbamic acid |
| SMILES | CC(C)(C)N(NC(=S)c1ccc2c(c1)CCCC(c1ccc(Cl)cc1Cl)=C2c1ccc(OC2CCN(CCCF)C2)cc1)C(=O)O |
| InChI | InChI=1S/C36H40Cl2FN3O3S/c1-36(2,3)42(35(43)44)40-34(46)25-10-14-29-24(20-25)6-4-7-31(30-15-11-26(37)21-32(30)38)33(29)23-8-12-27(13-9-23)45-28-16-19-41(22-28)18-5-17-39/h8-15,20-21,28H,4-7,16-19,22H2,1-3H3,(H,40,46)(H,43,44) |
| InChIKey | OXTATHMUNKHDFV-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.71 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|