C30H31ClF2N2O — CID 139396559
6-(3-chloro-2-fluorophenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-amine (PubChem CID 139396559) has the molecular formula C30H31ClF2N2O and a molecular weight of 509.04 g/mol. Its IUPAC name is 6-(3-chloro-2-fluorophenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-amine.
| Compound Name | 6-(3-chloro-2-fluorophenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-amine |
|---|---|
| PubChem CID | 139396559 |
| Molecular Formula | C30H31ClF2N2O |
| Molecular Weight | 509.04 g/mol |
| Exact Mass | 508.21 |
| IUPAC Name | 6-(3-chloro-2-fluorophenyl)-5-[4-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-amine |
| SMILES | Nc1ccc2c(c1)CCCC(c1cccc(Cl)c1F)=C2c1ccc(OC2CCN(CCCF)C2)cc1 |
| InChI | InChI=1S/C30H31ClF2N2O/c31-28-7-2-6-27(30(28)33)26-5-1-4-21-18-22(34)10-13-25(21)29(26)20-8-11-23(12-9-20)36-24-14-17-35(19-24)16-3-15-32/h2,6-13,18,24H,1,3-5,14-17,19,34H2 |
| InChIKey | SHDIPAQUJVQQAD-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.04 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|