C29H32F2N4O — CID 142351276
6-(2-fluoro-4-methylphenyl)-5-[2-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxypyrimidin-5-yl]-8,9-dihydro-7H-benzo[7]annulen-2-amine (PubChem CID 142351276) has the molecular formula C29H32F2N4O and a molecular weight of 490.60 g/mol. Its IUPAC name is 6-(2-fluoro-4-methylphenyl)-5-[2-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxypyrimidin-5-yl]-8,9-dihydro-7H-benzo[7]annulen-2-amine.
| Compound Name | 6-(2-fluoro-4-methylphenyl)-5-[2-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxypyrimidin-5-yl]-8,9-dihydro-7H-benzo[7]annulen-2-amine |
|---|---|
| PubChem CID | 142351276 |
| Molecular Formula | C29H32F2N4O |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 6-(2-fluoro-4-methylphenyl)-5-[2-[1-(3-fluoropropyl)pyrrolidin-3-yl]oxypyrimidin-5-yl]-8,9-dihydro-7H-benzo[7]annulen-2-amine |
| SMILES | Cc1ccc(C2=C(c3cnc(OC4CCN(CCCF)C4)nc3)c3ccc(N)cc3CCC2)c(F)c1 |
| InChI | InChI=1S/C29H32F2N4O/c1-19-6-8-25(27(31)14-19)26-5-2-4-20-15-22(32)7-9-24(20)28(26)21-16-33-29(34-17-21)36-23-10-13-35(18-23)12-3-11-30/h6-9,14-17,23H,2-5,10-13,18,32H2,1H3 |
| InChIKey | MNUMOBDRCNCSMB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|