C31H33F3N2O — CID 139396546
1-fluoro-6-(2-fluoro-4-methylphenyl)-5-[4-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-amine (PubChem CID 139396546) has the molecular formula C31H33F3N2O and a molecular weight of 506.61 g/mol. Its IUPAC name is 1-fluoro-6-(2-fluoro-4-methylphenyl)-5-[4-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-amine.
| Compound Name | 1-fluoro-6-(2-fluoro-4-methylphenyl)-5-[4-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-amine |
|---|---|
| PubChem CID | 139396546 |
| Molecular Formula | C31H33F3N2O |
| Molecular Weight | 506.61 g/mol |
| Exact Mass | 506.25 |
| IUPAC Name | 1-fluoro-6-(2-fluoro-4-methylphenyl)-5-[4-[(3S)-1-(3-fluoropropyl)pyrrolidin-3-yl]oxyphenyl]-8,9-dihydro-7H-benzo[7]annulen-2-amine |
| SMILES | Cc1ccc(C2=C(c3ccc(O[C@H]4CCN(CCCF)C4)cc3)c3ccc(N)c(F)c3CCC2)c(F)c1 |
| InChI | InChI=1S/C31H33F3N2O/c1-20-6-11-24(28(33)18-20)25-4-2-5-27-26(12-13-29(35)31(27)34)30(25)21-7-9-22(10-8-21)37-23-14-17-36(19-23)16-3-15-32/h6-13,18,23H,2-5,14-17,19,35H2,1H3/t23-/m0/s1 |
| InChIKey | VOAWTHJNTPCIJH-QHCPKHFHSA-N |
| XLogP | 6.96 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.61 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|