C25H21FN2 — CID 145352379
4-[2-amino-5-(4-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-6-yl]-2-fluorobenzonitrile (PubChem CID 145352379) has the molecular formula C25H21FN2 and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-[2-amino-5-(4-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-6-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[2-amino-5-(4-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-6-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 145352379 |
| Molecular Formula | C25H21FN2 |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 4-[2-amino-5-(4-methylphenyl)-8,9-dihydro-7H-benzo[7]annulen-6-yl]-2-fluorobenzonitrile |
| SMILES | Cc1ccc(C2=C(c3ccc(C#N)c(F)c3)CCCc3cc(N)ccc32)cc1 |
| InChI | InChI=1S/C25H21FN2/c1-16-5-7-17(8-6-16)25-22(19-9-10-20(15-27)24(26)14-19)4-2-3-18-13-21(28)11-12-23(18)25/h5-14H,2-4,28H2,1H3 |
| InChIKey | IIGFNLWITDSZNR-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|