C19H16F2N2O2S — CID 22746882
4-[2-(3-cyano-4-methylphenyl)cyclopenten-1-yl]-2,6-difluorobenzenesulfonamide (PubChem CID 22746882) has the molecular formula C19H16F2N2O2S and a molecular weight of 374.41 g/mol. Its IUPAC name is 4-[2-(3-cyano-4-methylphenyl)cyclopenten-1-yl]-2,6-difluorobenzenesulfonamide.
| Compound Name | 4-[2-(3-cyano-4-methylphenyl)cyclopenten-1-yl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 22746882 |
| Molecular Formula | C19H16F2N2O2S |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | 4-[2-(3-cyano-4-methylphenyl)cyclopenten-1-yl]-2,6-difluorobenzenesulfonamide |
| SMILES | Cc1ccc(C2=C(c3cc(F)c(S(N)(=O)=O)c(F)c3)CCC2)cc1C#N |
| InChI | InChI=1S/C19H16F2N2O2S/c1-11-5-6-12(7-14(11)10-22)15-3-2-4-16(15)13-8-17(20)19(18(21)9-13)26(23,24)25/h5-9H,2-4H2,1H3,(H2,23,24,25) |
| InChIKey | XHVGVJRUQYDZEK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|