C18H12F2N2O4S — CID 22745839
4-[4-(3-cyano-4-methylphenyl)-5-oxo-2H-furan-3-yl]-2,5-difluorobenzenesulfonamide (PubChem CID 22745839) has the molecular formula C18H12F2N2O4S and a molecular weight of 390.37 g/mol. Its IUPAC name is 4-[4-(3-cyano-4-methylphenyl)-5-oxo-2H-furan-3-yl]-2,5-difluorobenzenesulfonamide.
| Compound Name | 4-[4-(3-cyano-4-methylphenyl)-5-oxo-2H-furan-3-yl]-2,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 22745839 |
| Molecular Formula | C18H12F2N2O4S |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.05 |
| IUPAC Name | 4-[4-(3-cyano-4-methylphenyl)-5-oxo-2H-furan-3-yl]-2,5-difluorobenzenesulfonamide |
| SMILES | Cc1ccc(C2=C(c3cc(F)c(S(N)(=O)=O)cc3F)COC2=O)cc1C#N |
| InChI | InChI=1S/C18H12F2N2O4S/c1-9-2-3-10(4-11(9)7-21)17-13(8-26-18(17)23)12-5-15(20)16(6-14(12)19)27(22,24)25/h2-6H,8H2,1H3,(H2,22,24,25) |
| InChIKey | FRMFMXHDAQXILX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|