C17H10F2N2O4S — CID 22746089
4-[4-(4-cyanophenyl)-5-oxo-2H-furan-3-yl]-2,5-difluorobenzenesulfonamide (PubChem CID 22746089) has the molecular formula C17H10F2N2O4S and a molecular weight of 376.34 g/mol. Its IUPAC name is 4-[4-(4-cyanophenyl)-5-oxo-2H-furan-3-yl]-2,5-difluorobenzenesulfonamide.
| Compound Name | 4-[4-(4-cyanophenyl)-5-oxo-2H-furan-3-yl]-2,5-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 22746089 |
| Molecular Formula | C17H10F2N2O4S |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | 4-[4-(4-cyanophenyl)-5-oxo-2H-furan-3-yl]-2,5-difluorobenzenesulfonamide |
| SMILES | N#Cc1ccc(C2=C(c3cc(F)c(S(N)(=O)=O)cc3F)COC2=O)cc1 |
| InChI | InChI=1S/C17H10F2N2O4S/c18-13-6-15(26(21,23)24)14(19)5-11(13)12-8-25-17(22)16(12)10-3-1-9(7-20)2-4-10/h1-6H,8H2,(H2,21,23,24) |
| InChIKey | IQSHWSSMGIXQLU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 110.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|