C17H11FN2O2S2 — CID 139972086
4-[4-(3-cyanophenyl)thiophen-3-yl]-2-fluorobenzenesulfonamide (PubChem CID 139972086) has the molecular formula C17H11FN2O2S2 and a molecular weight of 358.42 g/mol. Its IUPAC name is 4-[4-(3-cyanophenyl)thiophen-3-yl]-2-fluorobenzenesulfonamide.
| Compound Name | 4-[4-(3-cyanophenyl)thiophen-3-yl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 139972086 |
| Molecular Formula | C17H11FN2O2S2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 4-[4-(3-cyanophenyl)thiophen-3-yl]-2-fluorobenzenesulfonamide |
| SMILES | N#Cc1cccc(-c2cscc2-c2ccc(S(N)(=O)=O)c(F)c2)c1 |
| InChI | InChI=1S/C17H11FN2O2S2/c18-16-7-13(4-5-17(16)24(20,21)22)15-10-23-9-14(15)12-3-1-2-11(6-12)8-19/h1-7,9-10H,(H2,20,21,22) |
| InChIKey | QRYYKYLJSGEAFB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |