C13H7F2N — CID 83810039
3-(2,6-difluorophenyl)benzonitrile (PubChem CID 83810039) has the molecular formula C13H7F2N and a molecular weight of 215.20 g/mol. Its IUPAC name is 3-(2,6-difluorophenyl)benzonitrile.
| Compound Name | 3-(2,6-difluorophenyl)benzonitrile |
|---|---|
| PubChem CID | 83810039 |
| Molecular Formula | C13H7F2N |
| Molecular Weight | 215.20 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 3-(2,6-difluorophenyl)benzonitrile |
| SMILES | N#Cc1cccc(-c2c(F)cccc2F)c1 |
| InChI | InChI=1S/C13H7F2N/c14-11-5-2-6-12(15)13(11)10-4-1-3-9(7-10)8-16/h1-7H |
| InChIKey | BFWOUVWXRKKEIS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.20 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |