About 3-fluorobenzonitrile;hydrochloride
3-fluorobenzonitrile;hydrochloride (PubChem CID 140590350) has the molecular formula C7H5ClFN
and a molecular weight of 157.57 g/mol. Its IUPAC name is 3-fluorobenzonitrile;hydrochloride.
Molecular Properties
| Compound Name | 3-fluorobenzonitrile;hydrochloride |
| PubChem CID | 140590350 |
| Molecular Formula | C7H5ClFN |
| Molecular Weight | 157.57 g/mol |
| Exact Mass | 157.01 |
| IUPAC Name | 3-fluorobenzonitrile;hydrochloride |
| SMILES | Cl.N#Cc1cccc(F)c1 |
| InChI | InChI=1S/C7H4FN.ClH/c8-7-3-1-2-6(4-7)5-9;/h1-4H;1H |
| InChIKey | HMSSZFNYUFMVIR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.57 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluorobenzonitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluorobenzonitrile;hydrochloride?
The IUPAC name of 3-fluorobenzonitrile;hydrochloride (CID 140590350) is 3-fluorobenzonitrile;hydrochloride.
What is the SMILES notation for 3-fluorobenzonitrile;hydrochloride?
The canonical SMILES for 3-fluorobenzonitrile;hydrochloride is Cl.N#Cc1cccc(F)c1.
What is the InChIKey of 3-fluorobenzonitrile;hydrochloride?
The InChIKey is HMSSZFNYUFMVIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FN.ClH/c8-7-3-1-2-6(4-7)5-9;/h1-4H;1H.
What are the key properties of 3-fluorobenzonitrile;hydrochloride?
3-fluorobenzonitrile;hydrochloride has a molecular weight of 157.57 g/mol, XLogP of 2.12, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluorobenzonitrile;hydrochloride is sourced from PubChem (CID 140590350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).