About 1-aminopropan-2-ol;3-fluorobenzonitrile
1-aminopropan-2-ol;3-fluorobenzonitrile (PubChem CID 174477470) has the molecular formula C10H13FN2O
and a molecular weight of 196.22 g/mol. Its IUPAC name is 1-aminopropan-2-ol;3-fluorobenzonitrile.
Molecular Properties
| Compound Name | 1-aminopropan-2-ol;3-fluorobenzonitrile |
| PubChem CID | 174477470 |
| Molecular Formula | C10H13FN2O |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-aminopropan-2-ol;3-fluorobenzonitrile |
| SMILES | CC(O)CN.N#Cc1cccc(F)c1 |
| InChI | InChI=1S/C7H4FN.C3H9NO/c8-7-3-1-2-6(4-7)5-9;1-3(5)2-4/h1-4H;3,5H,2,4H2,1H3 |
| InChIKey | FOXSPDWOBQRUNC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-aminopropan-2-ol;3-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopropan-2-ol;3-fluorobenzonitrile?
The IUPAC name of 1-aminopropan-2-ol;3-fluorobenzonitrile (CID 174477470) is 1-aminopropan-2-ol;3-fluorobenzonitrile.
What is the SMILES notation for 1-aminopropan-2-ol;3-fluorobenzonitrile?
The canonical SMILES for 1-aminopropan-2-ol;3-fluorobenzonitrile is CC(O)CN.N#Cc1cccc(F)c1.
What is the InChIKey of 1-aminopropan-2-ol;3-fluorobenzonitrile?
The InChIKey is FOXSPDWOBQRUNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FN.C3H9NO/c8-7-3-1-2-6(4-7)5-9;1-3(5)2-4/h1-4H;3,5H,2,4H2,1H3.
What are the key properties of 1-aminopropan-2-ol;3-fluorobenzonitrile?
1-aminopropan-2-ol;3-fluorobenzonitrile has a molecular weight of 196.22 g/mol, XLogP of 1.02, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopropan-2-ol;3-fluorobenzonitrile is sourced from PubChem (CID 174477470), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).