About ethane;3-fluorobenzonitrile
ethane;3-fluorobenzonitrile (PubChem CID 143604554) has the molecular formula C9H10FN
and a molecular weight of 151.18 g/mol. Its IUPAC name is ethane;3-fluorobenzonitrile.
Molecular Properties
| Compound Name | ethane;3-fluorobenzonitrile |
| PubChem CID | 143604554 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | ethane;3-fluorobenzonitrile |
| SMILES | CC.N#Cc1cccc(F)c1 |
| InChI | InChI=1S/C7H4FN.C2H6/c8-7-3-1-2-6(4-7)5-9;1-2/h1-4H;1-2H3 |
| InChIKey | IOKBFHLIKKBTPI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;3-fluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-fluorobenzonitrile?
The IUPAC name of ethane;3-fluorobenzonitrile (CID 143604554) is ethane;3-fluorobenzonitrile.
What is the SMILES notation for ethane;3-fluorobenzonitrile?
The canonical SMILES for ethane;3-fluorobenzonitrile is CC.N#Cc1cccc(F)c1.
What is the InChIKey of ethane;3-fluorobenzonitrile?
The InChIKey is IOKBFHLIKKBTPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FN.C2H6/c8-7-3-1-2-6(4-7)5-9;1-2/h1-4H;1-2H3.
What are the key properties of ethane;3-fluorobenzonitrile?
ethane;3-fluorobenzonitrile has a molecular weight of 151.18 g/mol, XLogP of 2.72, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-fluorobenzonitrile is sourced from PubChem (CID 143604554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).