C16H10FN — CID 11960675
3-fluoro-5-[2-(3-methylphenyl)ethynyl]benzonitrile (PubChem CID 11960675) has the molecular formula C16H10FN and a molecular weight of 235.26 g/mol. Its IUPAC name is 3-fluoro-5-[2-(3-methylphenyl)ethynyl]benzonitrile.
| Compound Name | 3-fluoro-5-[2-(3-methylphenyl)ethynyl]benzonitrile |
|---|---|
| PubChem CID | 11960675 |
| Molecular Formula | C16H10FN |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 3-fluoro-5-[2-(3-methylphenyl)ethynyl]benzonitrile |
| SMILES | Cc1cccc(C#Cc2cc(F)cc(C#N)c2)c1 |
| InChI | InChI=1S/C16H10FN/c1-12-3-2-4-13(7-12)5-6-14-8-15(11-18)10-16(17)9-14/h2-4,7-10H,1H3 |
| InChIKey | COPYBDULEFIWOI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|