C20H14 — CID 58986459
1-methyl-3-[6-(3-methylphenyl)hexa-1,3,5-triynyl]benzene (PubChem CID 58986459) has the molecular formula C20H14 and a molecular weight of 254.33 g/mol. Its IUPAC name is 1-methyl-3-[6-(3-methylphenyl)hexa-1,3,5-triynyl]benzene.
| Compound Name | 1-methyl-3-[6-(3-methylphenyl)hexa-1,3,5-triynyl]benzene |
|---|---|
| PubChem CID | 58986459 |
| Molecular Formula | C20H14 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 1-methyl-3-[6-(3-methylphenyl)hexa-1,3,5-triynyl]benzene |
| SMILES | Cc1cccc(C#CC#CC#Cc2cccc(C)c2)c1 |
| InChI | InChI=1S/C20H14/c1-17-9-7-13-19(15-17)11-5-3-4-6-12-20-14-8-10-18(2)16-20/h7-10,13-16H,1-2H3 |
| InChIKey | ASFGEBBIQNVTOF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|