C27H26 — CID 145152115
ethane;1-methyl-3,5-bis[2-(3-methylphenyl)ethynyl]benzene (PubChem CID 145152115) has the molecular formula C27H26 and a molecular weight of 350.51 g/mol. Its IUPAC name is ethane;1-methyl-3,5-bis[2-(3-methylphenyl)ethynyl]benzene.
| Compound Name | ethane;1-methyl-3,5-bis[2-(3-methylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 145152115 |
| Molecular Formula | C27H26 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | ethane;1-methyl-3,5-bis[2-(3-methylphenyl)ethynyl]benzene |
| SMILES | CC.Cc1cccc(C#Cc2cc(C)cc(C#Cc3cccc(C)c3)c2)c1 |
| InChI | InChI=1S/C25H20.C2H6/c1-19-6-4-8-22(14-19)10-12-24-16-21(3)17-25(18-24)13-11-23-9-5-7-20(2)15-23;1-2/h4-9,14-18H,1-3H3;1-2H3 |
| InChIKey | BHKMFZWGWGJJFO-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|