C21H12Br2Se — CID 71615250
3,4-dibromo-2-[2-(3-methylphenyl)ethynyl]-5-(2-phenylethynyl)selenophene (PubChem CID 71615250) has the molecular formula C21H12Br2Se and a molecular weight of 503.10 g/mol. Its IUPAC name is 3,4-dibromo-2-[2-(3-methylphenyl)ethynyl]-5-(2-phenylethynyl)selenophene.
| Compound Name | 3,4-dibromo-2-[2-(3-methylphenyl)ethynyl]-5-(2-phenylethynyl)selenophene |
|---|---|
| PubChem CID | 71615250 |
| Molecular Formula | C21H12Br2Se |
| Molecular Weight | 503.10 g/mol |
| Exact Mass | 501.85 |
| IUPAC Name | 3,4-dibromo-2-[2-(3-methylphenyl)ethynyl]-5-(2-phenylethynyl)selenophene |
| SMILES | Cc1cccc(C#Cc2[se]c(C#Cc3ccccc3)c(Br)c2Br)c1 |
| InChI | InChI=1S/C21H12Br2Se/c1-15-6-5-9-17(14-15)11-13-19-21(23)20(22)18(24-19)12-10-16-7-3-2-4-8-16/h2-9,14H,1H3 |
| InChIKey | DIPNELZZKLCUNU-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.10 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|