C14H20ClN — CID 45127578
N,N-diethyl-3-(3-methylphenyl)prop-2-yn-1-amine;hydrochloride (PubChem CID 45127578) has the molecular formula C14H20ClN and a molecular weight of 237.77 g/mol. Its IUPAC name is N,N-diethyl-3-(3-methylphenyl)prop-2-yn-1-amine;hydrochloride.
| Compound Name | N,N-diethyl-3-(3-methylphenyl)prop-2-yn-1-amine;hydrochloride |
|---|---|
| PubChem CID | 45127578 |
| Molecular Formula | C14H20ClN |
| Molecular Weight | 237.77 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | N,N-diethyl-3-(3-methylphenyl)prop-2-yn-1-amine;hydrochloride |
| SMILES | CCN(CC)CC#Cc1cccc(C)c1.Cl |
| InChI | InChI=1S/C14H19N.ClH/c1-4-15(5-2)11-7-10-14-9-6-8-13(3)12-14;/h6,8-9,12H,4-5,11H2,1-3H3;1H |
| InChIKey | QHYAXTSITXZWRU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.77 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|