C14H19NO — CID 11586570
N,N-diethyl-3-(3-methoxyphenyl)prop-2-yn-1-amine (PubChem CID 11586570) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is N,N-diethyl-3-(3-methoxyphenyl)prop-2-yn-1-amine.
| Compound Name | N,N-diethyl-3-(3-methoxyphenyl)prop-2-yn-1-amine |
|---|---|
| PubChem CID | 11586570 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | N,N-diethyl-3-(3-methoxyphenyl)prop-2-yn-1-amine |
| SMILES | CCN(CC)CC#Cc1cccc(OC)c1 |
| InChI | InChI=1S/C14H19NO/c1-4-15(5-2)11-7-9-13-8-6-10-14(12-13)16-3/h6,8,10,12H,4-5,11H2,1-3H3 |
| InChIKey | MVHBNBMCUAGZPA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|