C9H8O — CID 25117715
1-ethynyl-3-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (PubChem CID 25117715) has the molecular formula C9H8O and a molecular weight of 138.12 g/mol. Its IUPAC name is 1-ethynyl-3-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene.
| Compound Name | 1-ethynyl-3-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 25117715 |
| Molecular Formula | C9H8O |
| Molecular Weight | 138.12 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 1-ethynyl-3-methoxy(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| SMILES | C#C[13c]1[13cH][13cH][13cH][13c](OC)[13cH]1 |
| InChI | InChI=1S/C9H8O/c1-3-8-5-4-6-9(7-8)10-2/h1,4-7H,2H3/i4+1,5+1,6+1,7+1,8+1,9+1 |
| InChIKey | ZASXCTCNZKFDTP-VFESMUGCSA-N |
| XLogP | 1.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.12 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|