C17H25N — CID 146002814
3-(4-tert-butylphenyl)-N,N-diethylprop-2-yn-1-amine (PubChem CID 146002814) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-N,N-diethylprop-2-yn-1-amine.
| Compound Name | 3-(4-tert-butylphenyl)-N,N-diethylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 146002814 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 3-(4-tert-butylphenyl)-N,N-diethylprop-2-yn-1-amine |
| SMILES | CCN(CC)CC#Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C17H25N/c1-6-18(7-2)14-8-9-15-10-12-16(13-11-15)17(3,4)5/h10-13H,6-7,14H2,1-5H3 |
| InChIKey | TZJAGAIVYQLIBO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|