C15H21Cl2N — CID 3049689
3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine;hydrochloride (PubChem CID 3049689) has the molecular formula C15H21Cl2N and a molecular weight of 286.25 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine;hydrochloride.
| Compound Name | 3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine;hydrochloride |
|---|---|
| PubChem CID | 3049689 |
| Molecular Formula | C15H21Cl2N |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 3-(4-chlorophenyl)-N,N-dipropylprop-2-yn-1-amine;hydrochloride |
| SMILES | CCCN(CC#Cc1ccc(Cl)cc1)CCC.Cl |
| InChI | InChI=1S/C15H20ClN.ClH/c1-3-11-17(12-4-2)13-5-6-14-7-9-15(16)10-8-14;/h7-10H,3-4,11-13H2,1-2H3;1H |
| InChIKey | RVKOIEGUWBJRBP-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|