C31H28O4 — CID 138975409
diethyl 2,2-bis[5-(3-methylphenyl)penta-2,4-diynyl]propanedioate (PubChem CID 138975409) has the molecular formula C31H28O4 and a molecular weight of 464.56 g/mol. Its IUPAC name is diethyl 2,2-bis[5-(3-methylphenyl)penta-2,4-diynyl]propanedioate.
| Compound Name | diethyl 2,2-bis[5-(3-methylphenyl)penta-2,4-diynyl]propanedioate |
|---|---|
| PubChem CID | 138975409 |
| Molecular Formula | C31H28O4 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | diethyl 2,2-bis[5-(3-methylphenyl)penta-2,4-diynyl]propanedioate |
| SMILES | CCOC(=O)C(CC#CC#Cc1cccc(C)c1)(CC#CC#Cc1cccc(C)c1)C(=O)OCC |
| InChI | InChI=1S/C31H28O4/c1-5-34-29(32)31(30(33)35-6-2,21-11-7-9-17-27-19-13-15-25(3)23-27)22-12-8-10-18-28-20-14-16-26(4)24-28/h13-16,19-20,23-24H,5-6,21-22H2,1-4H3 |
| InChIKey | GUYRWCLPYFILEI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|