C31H26Cl2O4 — CID 138974963
dipropan-2-yl 2,2-bis[5-(4-chlorophenyl)penta-2,4-diynyl]propanedioate (PubChem CID 138974963) has the molecular formula C31H26Cl2O4 and a molecular weight of 533.45 g/mol. Its IUPAC name is dipropan-2-yl 2,2-bis[5-(4-chlorophenyl)penta-2,4-diynyl]propanedioate.
| Compound Name | dipropan-2-yl 2,2-bis[5-(4-chlorophenyl)penta-2,4-diynyl]propanedioate |
|---|---|
| PubChem CID | 138974963 |
| Molecular Formula | C31H26Cl2O4 |
| Molecular Weight | 533.45 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | dipropan-2-yl 2,2-bis[5-(4-chlorophenyl)penta-2,4-diynyl]propanedioate |
| SMILES | CC(C)OC(=O)C(CC#CC#Cc1ccc(Cl)cc1)(CC#CC#Cc1ccc(Cl)cc1)C(=O)OC(C)C |
| InChI | InChI=1S/C31H26Cl2O4/c1-23(2)36-29(34)31(30(35)37-24(3)4,21-9-5-7-11-25-13-17-27(32)18-14-25)22-10-6-8-12-26-15-19-28(33)20-16-26/h13-20,23-24H,21-22H2,1-4H3 |
| InChIKey | ZOZVIVYPQSJBDP-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.45 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|