C34H22O5 — CID 134313586
dimethyl 2-(4-hydroxyhexa-2,5-diynyl)-2-(7-pyren-2-ylhepta-2,4,6-triynyl)propanedioate (PubChem CID 134313586) has the molecular formula C34H22O5 and a molecular weight of 510.55 g/mol. Its IUPAC name is dimethyl 2-(4-hydroxyhexa-2,5-diynyl)-2-(7-pyren-2-ylhepta-2,4,6-triynyl)propanedioate.
| Compound Name | dimethyl 2-(4-hydroxyhexa-2,5-diynyl)-2-(7-pyren-2-ylhepta-2,4,6-triynyl)propanedioate |
|---|---|
| PubChem CID | 134313586 |
| Molecular Formula | C34H22O5 |
| Molecular Weight | 510.55 g/mol |
| Exact Mass | 510.15 |
| IUPAC Name | dimethyl 2-(4-hydroxyhexa-2,5-diynyl)-2-(7-pyren-2-ylhepta-2,4,6-triynyl)propanedioate |
| SMILES | C#CC(O)C#CCC(CC#CC#CC#Cc1cc2ccc3cccc4ccc(c1)c2c34)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C34H22O5/c1-4-29(35)15-11-21-34(32(36)38-2,33(37)39-3)20-9-7-5-6-8-12-24-22-27-18-16-25-13-10-14-26-17-19-28(23-24)31(27)30(25)26/h1,10,13-14,16-19,22-23,29,35H,20-21H2,2-3H3 |
| InChIKey | RZNGDSLEKVBBGG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.55 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|