C29H18F6O4 — CID 177454131
dimethyl 2,2-bis[5-[4-(trifluoromethyl)phenyl]penta-2,4-diynyl]propanedioate (PubChem CID 177454131) has the molecular formula C29H18F6O4 and a molecular weight of 544.45 g/mol. Its IUPAC name is dimethyl 2,2-bis[5-[4-(trifluoromethyl)phenyl]penta-2,4-diynyl]propanedioate.
| Compound Name | dimethyl 2,2-bis[5-[4-(trifluoromethyl)phenyl]penta-2,4-diynyl]propanedioate |
|---|---|
| PubChem CID | 177454131 |
| Molecular Formula | C29H18F6O4 |
| Molecular Weight | 544.45 g/mol |
| Exact Mass | 544.11 |
| IUPAC Name | dimethyl 2,2-bis[5-[4-(trifluoromethyl)phenyl]penta-2,4-diynyl]propanedioate |
| SMILES | COC(=O)C(CC#CC#Cc1ccc(C(F)(F)F)cc1)(CC#CC#Cc1ccc(C(F)(F)F)cc1)C(=O)OC |
| InChI | InChI=1S/C29H18F6O4/c1-38-25(36)27(26(37)39-2,19-7-3-5-9-21-11-15-23(16-12-21)28(30,31)32)20-8-4-6-10-22-13-17-24(18-14-22)29(33,34)35/h11-18H,19-20H2,1-2H3 |
| InChIKey | MWRQFOXFIJGKKV-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|