C15H17F3N2O — CID 97095399
(2S)-2-methyl-2-[3-[4-(trifluoromethyl)phenyl]prop-2-ynylamino]butanamide (PubChem CID 97095399) has the molecular formula C15H17F3N2O and a molecular weight of 298.31 g/mol. Its IUPAC name is (2S)-2-methyl-2-[3-[4-(trifluoromethyl)phenyl]prop-2-ynylamino]butanamide.
| Compound Name | (2S)-2-methyl-2-[3-[4-(trifluoromethyl)phenyl]prop-2-ynylamino]butanamide |
|---|---|
| PubChem CID | 97095399 |
| Molecular Formula | C15H17F3N2O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (2S)-2-methyl-2-[3-[4-(trifluoromethyl)phenyl]prop-2-ynylamino]butanamide |
| SMILES | CC[C@](C)(NCC#Cc1ccc(C(F)(F)F)cc1)C(N)=O |
| InChI | InChI=1S/C15H17F3N2O/c1-3-14(2,13(19)21)20-10-4-5-11-6-8-12(9-7-11)15(16,17)18/h6-9,20H,3,10H2,1-2H3,(H2,19,21)/t14-/m0/s1 |
| InChIKey | ZWMIXAIYHZXTLW-AWEZNQCLSA-N |
| XLogP | 2.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|