C18H14F3N3O3 — CID 11682310
N-hydroxy-4-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]prop-1-ynyl]benzamide (PubChem CID 11682310) has the molecular formula C18H14F3N3O3 and a molecular weight of 377.32 g/mol. Its IUPAC name is N-hydroxy-4-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]prop-1-ynyl]benzamide.
| Compound Name | N-hydroxy-4-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]prop-1-ynyl]benzamide |
|---|---|
| PubChem CID | 11682310 |
| Molecular Formula | C18H14F3N3O3 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-hydroxy-4-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]prop-1-ynyl]benzamide |
| SMILES | O=C(NCC#Cc1ccc(C(=O)NO)cc1)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H14F3N3O3/c19-18(20,21)14-7-9-15(10-8-14)23-17(26)22-11-1-2-12-3-5-13(6-4-12)16(25)24-27/h3-10,27H,11H2,(H,24,25)(H2,22,23,26) |
| InChIKey | YHPKSBMRARNZID-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|