C19H16F3N3O2 — CID 90553652
N-methyl-2-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]prop-1-ynyl]benzamide (PubChem CID 90553652) has the molecular formula C19H16F3N3O2 and a molecular weight of 375.35 g/mol. Its IUPAC name is N-methyl-2-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]prop-1-ynyl]benzamide.
| Compound Name | N-methyl-2-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]prop-1-ynyl]benzamide |
|---|---|
| PubChem CID | 90553652 |
| Molecular Formula | C19H16F3N3O2 |
| Molecular Weight | 375.35 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | N-methyl-2-[3-[[4-(trifluoromethyl)phenyl]carbamoylamino]prop-1-ynyl]benzamide |
| SMILES | CNC(=O)c1ccccc1C#CCNC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C19H16F3N3O2/c1-23-17(26)16-7-3-2-5-13(16)6-4-12-24-18(27)25-15-10-8-14(9-11-15)19(20,21)22/h2-3,5,7-11H,12H2,1H3,(H,23,26)(H2,24,25,27) |
| InChIKey | CSGOYOJVCCJXBO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|