C16H18F3N3 — CID 111823185
2-(cyclobutylmethyl)-1-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine (PubChem CID 111823185) has the molecular formula C16H18F3N3 and a molecular weight of 309.33 g/mol. Its IUPAC name is 2-(cyclobutylmethyl)-1-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine.
| Compound Name | 2-(cyclobutylmethyl)-1-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
|---|---|
| PubChem CID | 111823185 |
| Molecular Formula | C16H18F3N3 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 2-(cyclobutylmethyl)-1-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
| SMILES | N/C(=N\CC1CCC1)NCC#Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H18F3N3/c17-16(18,19)14-8-6-12(7-9-14)5-2-10-21-15(20)22-11-13-3-1-4-13/h6-9,13H,1,3-4,10-11H2,(H3,20,21,22) |
| InChIKey | BLDHJGYMURXLIQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|