C19H19F3IN3 — CID 111823168
1-(3,5-dimethylphenyl)-2-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide (PubChem CID 111823168) has the molecular formula C19H19F3IN3 and a molecular weight of 473.28 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-2-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide.
| Compound Name | 1-(3,5-dimethylphenyl)-2-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111823168 |
| Molecular Formula | C19H19F3IN3 |
| Molecular Weight | 473.28 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-2-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine;hydroiodide |
| SMILES | Cc1cc(C)cc(N/C(N)=N/CC#Cc2ccc(C(F)(F)F)cc2)c1.I |
| InChI | InChI=1S/C19H18F3N3.HI/c1-13-10-14(2)12-17(11-13)25-18(23)24-9-3-4-15-5-7-16(8-6-15)19(20,21)22;/h5-8,10-12H,9H2,1-2H3,(H3,23,24,25);1H |
| InChIKey | NZHOVHAXZHHLKH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.28 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|