C15H16F3N3O — CID 111823141
N'-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]morpholine-4-carboximidamide (PubChem CID 111823141) has the molecular formula C15H16F3N3O and a molecular weight of 311.31 g/mol. Its IUPAC name is N'-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]morpholine-4-carboximidamide.
| Compound Name | N'-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111823141 |
| Molecular Formula | C15H16F3N3O |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N'-[3-[4-(trifluoromethyl)phenyl]prop-2-ynyl]morpholine-4-carboximidamide |
| SMILES | N/C(=N\CC#Cc1ccc(C(F)(F)F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C15H16F3N3O/c16-15(17,18)13-5-3-12(4-6-13)2-1-7-20-14(19)21-8-10-22-11-9-21/h3-6H,7-11H2,(H2,19,20) |
| InChIKey | DOJXHBUBPMCIRK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|