C14H18F3N3O2 — CID 75493971
N'-[2-[4-(trifluoromethoxy)phenyl]ethyl]morpholine-4-carboximidamide (PubChem CID 75493971) has the molecular formula C14H18F3N3O2 and a molecular weight of 317.31 g/mol. Its IUPAC name is N'-[2-[4-(trifluoromethoxy)phenyl]ethyl]morpholine-4-carboximidamide.
| Compound Name | N'-[2-[4-(trifluoromethoxy)phenyl]ethyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 75493971 |
| Molecular Formula | C14H18F3N3O2 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N'-[2-[4-(trifluoromethoxy)phenyl]ethyl]morpholine-4-carboximidamide |
| SMILES | N/C(=N\CCc1ccc(OC(F)(F)F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C14H18F3N3O2/c15-14(16,17)22-12-3-1-11(2-4-12)5-6-19-13(18)20-7-9-21-10-8-20/h1-4H,5-10H2,(H2,18,19) |
| InChIKey | SJSHKQFZHHIDKT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|