C15H20F3N3O2 — CID 111091169
N'-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]piperidine-1-carboximidamide (PubChem CID 111091169) has the molecular formula C15H20F3N3O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is N'-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]piperidine-1-carboximidamide.
| Compound Name | N'-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111091169 |
| Molecular Formula | C15H20F3N3O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | N'-[2-hydroxy-2-[4-(trifluoromethoxy)phenyl]ethyl]piperidine-1-carboximidamide |
| SMILES | N/C(=N\CC(O)c1ccc(OC(F)(F)F)cc1)N1CCCCC1 |
| InChI | InChI=1S/C15H20F3N3O2/c16-15(17,18)23-12-6-4-11(5-7-12)13(22)10-20-14(19)21-8-2-1-3-9-21/h4-7,13,22H,1-3,8-10H2,(H2,19,20) |
| InChIKey | VIWYNWRJZYWYFZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|