C17H27ClIN3O — CID 111097140
N'-[2-(4-chlorophenyl)-2-ethylbutyl]morpholine-4-carboximidamide;hydroiodide (PubChem CID 111097140) has the molecular formula C17H27ClIN3O and a molecular weight of 451.78 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)-2-ethylbutyl]morpholine-4-carboximidamide;hydroiodide.
| Compound Name | N'-[2-(4-chlorophenyl)-2-ethylbutyl]morpholine-4-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111097140 |
| Molecular Formula | C17H27ClIN3O |
| Molecular Weight | 451.78 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | N'-[2-(4-chlorophenyl)-2-ethylbutyl]morpholine-4-carboximidamide;hydroiodide |
| SMILES | CCC(CC)(C/N=C(\N)N1CCOCC1)c1ccc(Cl)cc1.I |
| InChI | InChI=1S/C17H26ClN3O.HI/c1-3-17(4-2,14-5-7-15(18)8-6-14)13-20-16(19)21-9-11-22-12-10-21;/h5-8H,3-4,9-13H2,1-2H3,(H2,19,20);1H |
| InChIKey | VCHWIMSHNJGCJE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.78 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|