C18H27ClN4O — CID 111087099
N'-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]piperidine-1-carboximidamide (PubChem CID 111087099) has the molecular formula C18H27ClN4O and a molecular weight of 350.89 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]piperidine-1-carboximidamide.
| Compound Name | N'-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 111087099 |
| Molecular Formula | C18H27ClN4O |
| Molecular Weight | 350.89 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | N'-[2-(4-chlorophenyl)-2-morpholin-4-ylethyl]piperidine-1-carboximidamide |
| SMILES | N/C(=N\CC(c1ccc(Cl)cc1)N1CCOCC1)N1CCCCC1 |
| InChI | InChI=1S/C18H27ClN4O/c19-16-6-4-15(5-7-16)17(22-10-12-24-13-11-22)14-21-18(20)23-8-2-1-3-9-23/h4-7,17H,1-3,8-14H2,(H2,20,21) |
| InChIKey | XYUZNOGCMLVQTQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 54.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.89 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|