C15H24ClIN4O — CID 110936786
2-[2-(4-chlorophenyl)-2-(2,2-dimethylmorpholin-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 110936786) has the molecular formula C15H24ClIN4O and a molecular weight of 438.74 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-(2,2-dimethylmorpholin-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(4-chlorophenyl)-2-(2,2-dimethylmorpholin-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110936786 |
| Molecular Formula | C15H24ClIN4O |
| Molecular Weight | 438.74 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-(2,2-dimethylmorpholin-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CC1(C)CN(C(CN=C(N)N)c2ccc(Cl)cc2)CCO1.I |
| InChI | InChI=1S/C15H23ClN4O.HI/c1-15(2)10-20(7-8-21-15)13(9-19-14(17)18)11-3-5-12(16)6-4-11;/h3-6,13H,7-10H2,1-2H3,(H4,17,18,19);1H |
| InChIKey | SURXWTQQVAWWPR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 76.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.74 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|