C19H32Cl3N3O3 — CID 119876547
N-[2-(4-chlorophenyl)-2-(2,2-dimethylmorpholin-4-yl)ethyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride (PubChem CID 119876547) has the molecular formula C19H32Cl3N3O3 and a molecular weight of 456.84 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-2-(2,2-dimethylmorpholin-4-yl)ethyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride.
| Compound Name | N-[2-(4-chlorophenyl)-2-(2,2-dimethylmorpholin-4-yl)ethyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119876547 |
| Molecular Formula | C19H32Cl3N3O3 |
| Molecular Weight | 456.84 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N-[2-(4-chlorophenyl)-2-(2,2-dimethylmorpholin-4-yl)ethyl]-2-(2-methoxyethylamino)acetamide;dihydrochloride |
| SMILES | COCCNCC(=O)NCC(c1ccc(Cl)cc1)N1CCOC(C)(C)C1.Cl.Cl |
| InChI | InChI=1S/C19H30ClN3O3.2ClH/c1-19(2)14-23(9-11-26-19)17(15-4-6-16(20)7-5-15)12-22-18(24)13-21-8-10-25-3;;/h4-7,17,21H,8-14H2,1-3H3,(H,22,24);2*1H |
| InChIKey | IKANETGMUINMCV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.84 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|