C19H29ClN4O — CID 136859919
2-[2-(4-chlorophenyl)-2-(2,2-dimethylmorpholin-4-yl)ethyl]-1-(2-methylprop-2-enyl)guanidine (PubChem CID 136859919) has the molecular formula C19H29ClN4O and a molecular weight of 364.92 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-(2,2-dimethylmorpholin-4-yl)ethyl]-1-(2-methylprop-2-enyl)guanidine.
| Compound Name | 2-[2-(4-chlorophenyl)-2-(2,2-dimethylmorpholin-4-yl)ethyl]-1-(2-methylprop-2-enyl)guanidine |
|---|---|
| PubChem CID | 136859919 |
| Molecular Formula | C19H29ClN4O |
| Molecular Weight | 364.92 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-(2,2-dimethylmorpholin-4-yl)ethyl]-1-(2-methylprop-2-enyl)guanidine |
| SMILES | C=C(C)CN/C(N)=N/CC(c1ccc(Cl)cc1)N1CCOC(C)(C)C1 |
| InChI | InChI=1S/C19H29ClN4O/c1-14(2)11-22-18(21)23-12-17(15-5-7-16(20)8-6-15)24-9-10-25-19(3,4)13-24/h5-8,17H,1,9-13H2,2-4H3,(H3,21,22,23) |
| InChIKey | JMOWBMWVCZTJQK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.92 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|