C8H17N3O — CID 62972618
N'-ethyl-1,4-oxazepane-4-carboximidamide (PubChem CID 62972618) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is N'-ethyl-1,4-oxazepane-4-carboximidamide.
| Compound Name | N'-ethyl-1,4-oxazepane-4-carboximidamide |
|---|---|
| PubChem CID | 62972618 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | N'-ethyl-1,4-oxazepane-4-carboximidamide |
| SMILES | CC/N=C(\N)N1CCCOCC1 |
| InChI | InChI=1S/C8H17N3O/c1-2-10-8(9)11-4-3-6-12-7-5-11/h2-7H2,1H3,(H2,9,10) |
| InChIKey | XCTIARFRTYPMPH-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|